C47H58O5Si — CID 11556737
tert-butyl-[(2S,3S,4R,5S,6S)-2-methoxy-4,6-dimethyl-3,5,7-tris(phenylmethoxy)heptoxy]-diphenylsilane (PubChem CID 11556737) has the molecular formula C47H58O5Si and a molecular weight of 731.06 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4R,5S,6S)-2-methoxy-4,6-dimethyl-3,5,7-tris(phenylmethoxy)heptoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,3S,4R,5S,6S)-2-methoxy-4,6-dimethyl-3,5,7-tris(phenylmethoxy)heptoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11556737 |
| Molecular Formula | C47H58O5Si |
| Molecular Weight | 731.06 g/mol |
| Exact Mass | 730.41 |
| IUPAC Name | tert-butyl-[(2S,3S,4R,5S,6S)-2-methoxy-4,6-dimethyl-3,5,7-tris(phenylmethoxy)heptoxy]-diphenylsilane |
| SMILES | CO[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](OCc1ccccc1)[C@H](C)[C@@H](OCc1ccccc1)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C47H58O5Si/c1-37(32-49-33-39-22-12-7-13-23-39)45(50-34-40-24-14-8-15-25-40)38(2)46(51-35-41-26-16-9-17-27-41)44(48-6)36-52-53(47(3,4)5,42-28-18-10-19-29-42)43-30-20-11-21-31-43/h7-31,37-38,44-46H,32-36H2,1-6H3/t37-,38+,44-,45-,46-/m0/s1 |
| InChIKey | DVSJHHRSLIFOAX-CYKIFUSISA-N |
| XLogP | 9.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.06 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|