C27H33FO3Si — CID 140879334
(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-4-phenylmethoxybutan-2-ol (PubChem CID 140879334) has the molecular formula C27H33FO3Si and a molecular weight of 452.64 g/mol. Its IUPAC name is (2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-4-phenylmethoxybutan-2-ol.
| Compound Name | (2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-4-phenylmethoxybutan-2-ol |
|---|---|
| PubChem CID | 140879334 |
| Molecular Formula | C27H33FO3Si |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-4-phenylmethoxybutan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@H](O)[C@H](F)COCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33FO3Si/c1-27(2,3)32(23-15-9-5-10-16-23,24-17-11-6-12-18-24)31-21-26(29)25(28)20-30-19-22-13-7-4-8-14-22/h4-18,25-26,29H,19-21H2,1-3H3/t25-,26+/m1/s1 |
| InChIKey | WNRQCXCJTKTDLN-FTJBHMTQSA-N |
| XLogP | 4.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|