C29H36O5Si — CID 18649513
1-[(2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl]-2-phenylmethoxyethanol (PubChem CID 18649513) has the molecular formula C29H36O5Si and a molecular weight of 492.69 g/mol. Its IUPAC name is 1-[(2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl]-2-phenylmethoxyethanol.
| Compound Name | 1-[(2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 18649513 |
| Molecular Formula | C29H36O5Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 1-[(2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl]-2-phenylmethoxyethanol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1OC[C@H](C(O)COCc2ccccc2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H36O5Si/c1-29(2,3)35(24-15-9-5-10-16-24,25-17-11-6-12-18-25)33-22-28-32-21-27(34-28)26(30)20-31-19-23-13-7-4-8-14-23/h4-18,26-28,30H,19-22H2,1-3H3/t26?,27-,28-/m1/s1 |
| InChIKey | WGHLVKXVXTYBRI-DXISBFFWSA-N |
| XLogP | 3.88 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|