C33H39NO5Si — CID 123562509
(2S)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(5S)-3-ethynyl-4,5-dihydro-1,2-oxazol-5-yl]ethoxy]-3-phenylmethoxypropan-2-ol (PubChem CID 123562509) has the molecular formula C33H39NO5Si and a molecular weight of 557.76 g/mol. Its IUPAC name is (2S)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(5S)-3-ethynyl-4,5-dihydro-1,2-oxazol-5-yl]ethoxy]-3-phenylmethoxypropan-2-ol.
| Compound Name | (2S)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(5S)-3-ethynyl-4,5-dihydro-1,2-oxazol-5-yl]ethoxy]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 123562509 |
| Molecular Formula | C33H39NO5Si |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | (2S)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(5S)-3-ethynyl-4,5-dihydro-1,2-oxazol-5-yl]ethoxy]-3-phenylmethoxypropan-2-ol |
| SMILES | C#CC1=NO[C@H]([C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC[C@@H](O)COCc2ccccc2)C1 |
| InChI | InChI=1S/C33H39NO5Si/c1-5-27-21-31(39-34-27)32(37-24-28(35)23-36-22-26-15-9-6-10-16-26)25-38-40(33(2,3)4,29-17-11-7-12-18-29)30-19-13-8-14-20-30/h1,6-20,28,31-32,35H,21-25H2,2-4H3/t28-,31-,32+/m0/s1 |
| InChIKey | NMVBWBSFAXNGHR-JWBZKWLISA-N |
| XLogP | 4.30 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|