C24H31NO3Si — CID 101079089
(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(5R)-3-prop-1-en-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol (PubChem CID 101079089) has the molecular formula C24H31NO3Si and a molecular weight of 409.60 g/mol. Its IUPAC name is (1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(5R)-3-prop-1-en-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol.
| Compound Name | (1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(5R)-3-prop-1-en-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 101079089 |
| Molecular Formula | C24H31NO3Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(5R)-3-prop-1-en-2-yl-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
| SMILES | C=C(C)C1=NO[C@@H]([C@@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H31NO3Si/c1-18(2)21-16-23(28-25-21)22(26)17-27-29(24(3,4)5,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,22-23,26H,1,16-17H2,2-5H3/t22-,23+/m0/s1 |
| InChIKey | FOARKCDTIMTOJM-XZOQPEGZSA-N |
| XLogP | 3.64 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|