C25H36O5Si — CID 23242980
(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4R,5S)-5-[(1S)-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 23242980) has the molecular formula C25H36O5Si and a molecular weight of 444.64 g/mol. Its IUPAC name is (1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4R,5S)-5-[(1S)-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4R,5S)-5-[(1S)-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 23242980 |
| Molecular Formula | C25H36O5Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4R,5S)-5-[(1S)-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | C[C@H](O)[C@@H]1OC(C)(C)O[C@@H]1[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36O5Si/c1-18(26)22-23(30-25(5,6)29-22)21(27)17-28-31(24(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21-23,26-27H,17H2,1-6H3/t18-,21+,22-,23+/m0/s1 |
| InChIKey | NDLNXWOELHAVCX-OUFMZXHOSA-N |
| XLogP | 2.82 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|