C32H42O5Si — CID 122366240
(R)-[(4R,5R)-5-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-ethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethanol (PubChem CID 122366240) has the molecular formula C32H42O5Si and a molecular weight of 534.77 g/mol. Its IUPAC name is (R)-[(4R,5R)-5-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-ethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethanol.
| Compound Name | (R)-[(4R,5R)-5-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-ethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethanol |
|---|---|
| PubChem CID | 122366240 |
| Molecular Formula | C32H42O5Si |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | (R)-[(4R,5R)-5-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-ethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethanol |
| SMILES | CCO[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C32H42O5Si/c1-7-34-27(29-30(37-32(5,6)36-29)28(33)24-17-11-8-12-18-24)23-35-38(31(2,3)4,25-19-13-9-14-20-25)26-21-15-10-16-22-26/h8-22,27-30,33H,7,23H2,1-6H3/t27-,28+,29+,30+/m0/s1 |
| InChIKey | QUKHJIRXBIAHES-MIPYOGIXSA-N |
| XLogP | 5.22 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|