C27H38O5Si — CID 59047996
(1S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxybutan-2-one (PubChem CID 59047996) has the molecular formula C27H38O5Si and a molecular weight of 470.68 g/mol. Its IUPAC name is (1S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxybutan-2-one.
| Compound Name | (1S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxybutan-2-one |
|---|---|
| PubChem CID | 59047996 |
| Molecular Formula | C27H38O5Si |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (1S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxybutan-2-one |
| SMILES | CCC(=O)[C@@H](OC)[C@H]1OC(C)(C)O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38O5Si/c1-8-22(28)24(29-7)25-23(31-27(5,6)32-25)19-30-33(26(2,3)4,20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-18,23-25H,8,19H2,1-7H3/t23-,24+,25-/m0/s1 |
| InChIKey | GUXZOPMUVOAAKG-GVAUOCQISA-N |
| XLogP | 4.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|