C29H42O5Si — CID 59047957
(1R,2S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxy-2-methylpent-4-en-2-ol (PubChem CID 59047957) has the molecular formula C29H42O5Si and a molecular weight of 498.74 g/mol. Its IUPAC name is (1R,2S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxy-2-methylpent-4-en-2-ol.
| Compound Name | (1R,2S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxy-2-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 59047957 |
| Molecular Formula | C29H42O5Si |
| Molecular Weight | 498.74 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | (1R,2S)-1-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxy-2-methylpent-4-en-2-ol |
| SMILES | C=CC[C@](C)(O)[C@H](OC)[C@H]1OC(C)(C)O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H42O5Si/c1-9-20-29(7,30)26(31-8)25-24(33-28(5,6)34-25)21-32-35(27(2,3)4,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h9-19,24-26,30H,1,20-21H2,2-8H3/t24-,25-,26+,29-/m0/s1 |
| InChIKey | QXVANUQTOCLEGC-QNVWVOQGSA-N |
| XLogP | 4.43 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.74 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|