C30H44O3S2Si — CID 11421408
tert-butyl-[[(4R,5S,6R)-6-[(1S)-1-(1,3-dithian-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methoxy]-diphenylsilane (PubChem CID 11421408) has the molecular formula C30H44O3S2Si and a molecular weight of 544.90 g/mol. Its IUPAC name is tert-butyl-[[(4R,5S,6R)-6-[(1S)-1-(1,3-dithian-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(4R,5S,6R)-6-[(1S)-1-(1,3-dithian-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11421408 |
| Molecular Formula | C30H44O3S2Si |
| Molecular Weight | 544.90 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | tert-butyl-[[(4R,5S,6R)-6-[(1S)-1-(1,3-dithian-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methoxy]-diphenylsilane |
| SMILES | C[C@H]1[C@H]([C@H](C)C2SCCCS2)OC(C)(C)O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H44O3S2Si/c1-22-26(32-30(6,7)33-27(22)23(2)28-34-19-14-20-35-28)21-31-36(29(3,4)5,24-15-10-8-11-16-24)25-17-12-9-13-18-25/h8-13,15-18,22-23,26-28H,14,19-21H2,1-7H3/t22-,23+,26+,27-/m1/s1 |
| InChIKey | RQTNIMHBCNKUBB-GXVHRJHYSA-N |
| XLogP | 6.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.90 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|