C28H38O4S2Si — CID 11409997
[(3aR,5S,6R,6aR)-6-(1,3-dithian-2-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 11409997) has the molecular formula C28H38O4S2Si and a molecular weight of 530.83 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-6-(1,3-dithian-2-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,5S,6R,6aR)-6-(1,3-dithian-2-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11409997 |
| Molecular Formula | C28H38O4S2Si |
| Molecular Weight | 530.83 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | [(3aR,5S,6R,6aR)-6-(1,3-dithian-2-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](C3SCCCS3)[C@H]2O1 |
| InChI | InChI=1S/C28H38O4S2Si/c1-27(2,3)35(20-13-8-6-9-14-20,21-15-10-7-11-16-21)29-19-22-23(26-33-17-12-18-34-26)24-25(30-22)32-28(4,5)31-24/h6-11,13-16,22-26H,12,17-19H2,1-5H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | VWAPWEAWZDDFNC-ZGFBMJKBSA-N |
| XLogP | 5.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.83 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|