C27H36O6Si — CID 123880109
[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 123880109) has the molecular formula C27H36O6Si and a molecular weight of 484.67 g/mol. Its IUPAC name is [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 123880109 |
| Molecular Formula | C27H36O6Si |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C27H36O6Si/c1-19(28)29-17-22-23(31-25-24(22)32-27(5,6)33-25)18-30-34(26(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,22-25H,17-18H2,1-6H3 |
| InChIKey | RLICYHSKLUDNCC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|