C32H38O6Si — CID 10886103
1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanone (PubChem CID 10886103) has the molecular formula C32H38O6Si and a molecular weight of 546.74 g/mol. Its IUPAC name is 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanone.
| Compound Name | 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanone |
|---|---|
| PubChem CID | 10886103 |
| Molecular Formula | C32H38O6Si |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanone |
| SMILES | CC1(C)O[C@H]2O[C@H](C(=O)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C32H38O6Si/c1-31(2,3)39(24-17-11-7-12-18-24,25-19-13-8-14-20-25)35-22-26(33)27-28(34-21-23-15-9-6-10-16-23)29-30(36-27)38-32(4,5)37-29/h6-20,27-30H,21-22H2,1-5H3/t27-,28+,29-,30-/m1/s1 |
| InChIKey | KZKQOXLJWCVVKB-GOGZTAQTSA-N |
| XLogP | 4.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|