C20H26O7 — CID 11773343
1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(1,3-dioxolan-2-yl)propan-1-one (PubChem CID 11773343) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(1,3-dioxolan-2-yl)propan-1-one.
| Compound Name | 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(1,3-dioxolan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 11773343 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(1,3-dioxolan-2-yl)propan-1-one |
| SMILES | CC1(C)O[C@H]2O[C@H](C(=O)CCC3OCCO3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C20H26O7/c1-20(2)26-18-17(24-12-13-6-4-3-5-7-13)16(25-19(18)27-20)14(21)8-9-15-22-10-11-23-15/h3-7,15-19H,8-12H2,1-2H3/t16-,17+,18-,19-/m1/s1 |
| InChIKey | GWRYGXQLRTWSHC-FCGDIQPGSA-N |
| XLogP | 2.17 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |