C23H24O7 — CID 14212520
[2-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxoethyl] benzoate (PubChem CID 14212520) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is [2-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxoethyl] benzoate.
| Compound Name | [2-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 14212520 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [2-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxoethyl] benzoate |
| SMILES | CC1(C)O[C@H]2O[C@H](C(=O)COC(=O)c3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C23H24O7/c1-23(2)29-20-19(26-13-15-9-5-3-6-10-15)18(28-22(20)30-23)17(24)14-27-21(25)16-11-7-4-8-12-16/h3-12,18-20,22H,13-14H2,1-2H3/t18-,19+,20-,22-/m1/s1 |
| InChIKey | NPUNVVRLISHKJT-XAPVIXHLSA-N |
| XLogP | 2.87 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |