C26H30O7 — CID 23243472
[(5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]methyl benzoate (PubChem CID 23243472) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is [(5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 23243472 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [(5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]methyl benzoate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H]3CCC(COC(=O)c4ccccc4)O3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C26H30O7/c1-26(2)32-23-22(28-15-17-9-5-3-6-10-17)21(31-25(23)33-26)20-14-13-19(30-20)16-29-24(27)18-11-7-4-8-12-18/h3-12,19-23,25H,13-16H2,1-2H3/t19?,20-,21+,22-,23+,25+/m0/s1 |
| InChIKey | JQBFQGORGVYEBS-GLOMWHTJSA-N |
| XLogP | 3.85 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |