C23H26O6 — CID 167192071
[(3aR,5R)-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate (PubChem CID 167192071) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is [(3aR,5R)-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate.
| Compound Name | [(3aR,5R)-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 167192071 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [(3aR,5R)-2,2-dimethyl-7-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate |
| SMILES | CC1(C)OC2C(OCc3ccccc3)C[C@H](COC(=O)c3ccccc3)O[C@@H]2O1 |
| InChI | InChI=1S/C23H26O6/c1-23(2)28-20-19(25-14-16-9-5-3-6-10-16)13-18(27-22(20)29-23)15-26-21(24)17-11-7-4-8-12-17/h3-12,18-20,22H,13-15H2,1-2H3/t18-,19?,20?,22-/m1/s1 |
| InChIKey | OTFLEKFCFUXMJM-FYYGKBSSSA-N |
| XLogP | 3.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |