C15H17ClO5 — CID 15221190
(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbonyl chloride (PubChem CID 15221190) has the molecular formula C15H17ClO5 and a molecular weight of 312.75 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbonyl chloride.
| Compound Name | (3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbonyl chloride |
|---|---|
| PubChem CID | 15221190 |
| Molecular Formula | C15H17ClO5 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbonyl chloride |
| SMILES | CC1(C)O[C@H]2O[C@H](C(=O)Cl)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C15H17ClO5/c1-15(2)20-12-10(11(13(16)17)19-14(12)21-15)18-8-9-6-4-3-5-7-9/h3-7,10-12,14H,8H2,1-2H3/t10-,11-,12+,14+/m0/s1 |
| InChIKey | JQOCSKUMWQTZBC-CIQGVGRVSA-N |
| XLogP | 2.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|