C17H22O6 — CID 139464702
1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropan-2-one (PubChem CID 139464702) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropan-2-one.
| Compound Name | 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropan-2-one |
|---|---|
| PubChem CID | 139464702 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropan-2-one |
| SMILES | CC1(C)O[C@H]2O[C@H](CC(=O)CO)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C17H22O6/c1-17(2)22-15-14(20-10-11-6-4-3-5-7-11)13(8-12(19)9-18)21-16(15)23-17/h3-7,13-16,18H,8-10H2,1-2H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | IIIMXJNDZLLXEL-QKPAOTATSA-N |
| XLogP | 1.40 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |