C16H19F3O7S — CID 11004172
[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate (PubChem CID 11004172) has the molecular formula C16H19F3O7S and a molecular weight of 412.38 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11004172 |
| Molecular Formula | C16H19F3O7S |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H](COS(=O)(=O)C(F)(F)F)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C16H19F3O7S/c1-15(2)25-13-12(22-8-10-6-4-3-5-7-10)11(24-14(13)26-15)9-23-27(20,21)16(17,18)19/h3-7,11-14H,8-9H2,1-2H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | IOHIFFLNVDAVIK-XJFOESAGSA-N |
| XLogP | 2.31 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|