C9H13F3O7S — CID 88880796
[(3aR,5R,6R,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate (PubChem CID 88880796) has the molecular formula C9H13F3O7S and a molecular weight of 322.26 g/mol. Its IUPAC name is [(3aR,5R,6R,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(3aR,5R,6R,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88880796 |
| Molecular Formula | C9H13F3O7S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | [(3aR,5R,6R,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H](COS(=O)(=O)C(F)(F)F)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C9H13F3O7S/c1-8(2)18-6-5(13)4(17-7(6)19-8)3-16-20(14,15)9(10,11)12/h4-7,13H,3H2,1-2H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | FJLDCGODCCKDGZ-DBRKOABJSA-N |
| XLogP | 0.09 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|