C13H19F3O8S — CID 12687187
(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl trifluoromethanesulfonate (PubChem CID 12687187) has the molecular formula C13H19F3O8S and a molecular weight of 392.35 g/mol. Its IUPAC name is (4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl trifluoromethanesulfonate.
| Compound Name | (4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12687187 |
| Molecular Formula | C13H19F3O8S |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl trifluoromethanesulfonate |
| SMILES | CC1(C)OC2OC(COS(=O)(=O)C(F)(F)F)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C13H19F3O8S/c1-11(2)21-7-6(5-19-25(17,18)13(14,15)16)20-10-9(8(7)22-11)23-12(3,4)24-10/h6-10H,5H2,1-4H3 |
| InChIKey | RWRSXLJBCGQYQP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|