C11H15F3O8S — CID 88884433
[(3aR,5R,6R,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate (PubChem CID 88884433) has the molecular formula C11H15F3O8S and a molecular weight of 364.29 g/mol. Its IUPAC name is [(3aR,5R,6R,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate.
| Compound Name | [(3aR,5R,6R,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 88884433 |
| Molecular Formula | C11H15F3O8S |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | [(3aR,5R,6R,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O8S/c1-5(15)18-4-6-7(22-23(16,17)11(12,13)14)8-9(19-6)21-10(2,3)20-8/h6-9H,4H2,1-3H3/t6-,7-,8-,9-/m1/s1 |
| InChIKey | ASHKBSYIRFWTMY-FNCVBFRFSA-N |
| XLogP | 0.66 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|