C11H18O5 — CID 58526271
[(5S,6S,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate (PubChem CID 58526271) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is [(5S,6S,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate.
| Compound Name | [(5S,6S,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 58526271 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | [(5S,6S,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C11H18O5/c1-6-8(5-13-7(2)12)14-10-9(6)15-11(3,4)16-10/h6,8-10H,5H2,1-4H3/t6-,8+,9+,10?/m0/s1 |
| InChIKey | SZICWQCYWVETDD-CEPLBNANSA-N |
| XLogP | 1.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |