C13H22O6 — CID 174331511
[(3aR,6R,7S)-2-methoxy-2,6,7-trimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate (PubChem CID 174331511) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is [(3aR,6R,7S)-2-methoxy-2,6,7-trimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate.
| Compound Name | [(3aR,6R,7S)-2-methoxy-2,6,7-trimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate |
|---|---|
| PubChem CID | 174331511 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [(3aR,6R,7S)-2-methoxy-2,6,7-trimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate |
| SMILES | COC1(C)OC2[C@H](OC(COC(C)=O)[C@H](C)[C@@H]2C)O1 |
| InChI | InChI=1S/C13H22O6/c1-7-8(2)11-12(19-13(4,15-5)18-11)17-10(7)6-16-9(3)14/h7-8,10-12H,6H2,1-5H3/t7-,8+,10?,11?,12-,13?/m1/s1 |
| InChIKey | OLHQTNKIYODROP-LJTCHENOSA-N |
| XLogP | 1.28 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |