C27H42O15 — CID 161274867
[(2S,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanol;[(2R,3R,4R,5S)-4,5,6-triacetyloxy-3-methyloxan-2-yl]methyl acetate (PubChem CID 161274867) has the molecular formula C27H42O15 and a molecular weight of 606.62 g/mol. Its IUPAC name is [(2S,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanol;[(2R,3R,4R,5S)-4,5,6-triacetyloxy-3-methyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanol;[(2R,3R,4R,5S)-4,5,6-triacetyloxy-3-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 161274867 |
| Molecular Formula | C27H42O15 |
| Molecular Weight | 606.62 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | [(2S,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanol;[(2R,3R,4R,5S)-4,5,6-triacetyloxy-3-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OC(OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1C.CC1(C)OC2O[C@@H](CO)[C@H]3OC(C)(C)OC3[C@@H]2O1 |
| InChI | InChI=1S/C15H22O9.C12H20O6/c1-7-12(6-20-8(2)16)24-15(23-11(5)19)14(22-10(4)18)13(7)21-9(3)17;1-11(2)15-7-6(5-13)14-10-9(8(7)16-11)17-12(3,4)18-10/h7,12-15H,6H2,1-5H3;6-10,13H,5H2,1-4H3/t7-,12+,13-,14+,15?;6-,7+,8?,9-,10?/m10/s1 |
| InChIKey | VEHMQRLBWAHEJC-GVOSOEHMSA-N |
| XLogP | 0.71 |
| TPSA | 180.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.62 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|