C27H40O14S — CID 101476063
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethylsulfanyl]oxan-2-yl]methyl acetate (PubChem CID 101476063) has the molecular formula C27H40O14S and a molecular weight of 620.67 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethylsulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethylsulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101476063 |
| Molecular Formula | C27H40O14S |
| Molecular Weight | 620.67 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethylsulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](SCC[C@@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H40O14S/c1-12(28)32-11-17-18(33-13(2)29)20(34-14(3)30)23(35-15(4)31)25(37-17)42-10-9-16-19-21(39-26(5,6)38-19)22-24(36-16)41-27(7,8)40-22/h16-25H,9-11H2,1-8H3/t16-,17+,18+,19-,20-,21-,22+,23-,24+,25+/m0/s1 |
| InChIKey | UANFATBXPWQKQY-LAKSPDHXSA-N |
| XLogP | 1.59 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.67 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|