C15H24O7S — CID 101138668
[(3aS,4R,7R,7aS)-7-acetyloxy-6-ethylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate (PubChem CID 101138668) has the molecular formula C15H24O7S and a molecular weight of 348.42 g/mol. Its IUPAC name is [(3aS,4R,7R,7aS)-7-acetyloxy-6-ethylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate.
| Compound Name | [(3aS,4R,7R,7aS)-7-acetyloxy-6-ethylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate |
|---|---|
| PubChem CID | 101138668 |
| Molecular Formula | C15H24O7S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(3aS,4R,7R,7aS)-7-acetyloxy-6-ethylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate |
| SMILES | CCSC1O[C@H](COC(C)=O)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H24O7S/c1-6-23-14-13(19-9(3)17)12-11(21-15(4,5)22-12)10(20-14)7-18-8(2)16/h10-14H,6-7H2,1-5H3/t10-,11+,12+,13-,14?/m1/s1 |
| InChIKey | BCLGITFQZUSRSC-RRYROLNDSA-N |
| XLogP | 1.48 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |