C10H15ClO5 — CID 176521843
[(3aR,4S,6R,6aR)-4-chloro-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 176521843) has the molecular formula C10H15ClO5 and a molecular weight of 250.68 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-4-chloro-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [(3aR,4S,6R,6aR)-4-chloro-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 176521843 |
| Molecular Formula | C10H15ClO5 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | [(3aR,4S,6R,6aR)-4-chloro-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Cl)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C10H15ClO5/c1-5(12)13-4-6-7-8(9(11)14-6)16-10(2,3)15-7/h6-9H,4H2,1-3H3/t6-,7-,8-,9-/m1/s1 |
| InChIKey | VJZJQRLAACIGSA-FNCVBFRFSA-N |
| XLogP | 1.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|