C16H20O5 — CID 177364849
[(3aS,6aR)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 177364849) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is [(3aS,6aR)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [(3aS,6aR)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 177364849 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [(3aS,6aR)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(c2ccccc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H20O5/c1-10(17)18-9-12-14-15(21-16(2,3)20-14)13(19-12)11-7-5-4-6-8-11/h4-8,12-15H,9H2,1-3H3/t12?,13?,14-,15+/m1/s1 |
| InChIKey | SHDCTAAYDJJVKQ-CVSAEHQPSA-N |
| XLogP | 2.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |