C21H22O5 — CID 73056661
[(3aR,4R,6R,6aS)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate (PubChem CID 73056661) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(3aR,4R,6R,6aS)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate.
| Compound Name | [(3aR,4R,6R,6aS)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 73056661 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(3aR,4R,6R,6aS)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](c1ccccc1)O[C@@H]2COC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22O5/c1-21(2)25-18-16(13-23-20(22)15-11-7-4-8-12-15)24-17(19(18)26-21)14-9-5-3-6-10-14/h3-12,16-19H,13H2,1-2H3/t16-,17-,18+,19-/m1/s1 |
| InChIKey | HYHQGDUCXWFNFJ-AKHDSKFASA-N |
| XLogP | 3.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |