C30H31ClO6 — CID 164675375
[(3aS,4S,6R,6aR)-4-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate (PubChem CID 164675375) has the molecular formula C30H31ClO6 and a molecular weight of 523.03 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-4-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate.
| Compound Name | [(3aS,4S,6R,6aR)-4-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 164675375 |
| Molecular Formula | C30H31ClO6 |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [(3aS,4S,6R,6aR)-4-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](COC(=O)c4ccccc4)[C@H]4OC(C)(C)O[C@H]43)ccc2Cl)cc1 |
| InChI | InChI=1S/C30H31ClO6/c1-4-33-23-13-10-19(11-14-23)16-22-17-21(12-15-24(22)31)26-28-27(36-30(2,3)37-28)25(35-26)18-34-29(32)20-8-6-5-7-9-20/h5-15,17,25-28H,4,16,18H2,1-3H3/t25-,26+,27-,28+/m1/s1 |
| InChIKey | QAGMCJHUROXPPN-GCFVYEKYSA-N |
| XLogP | 6.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |