C23H25ClO5 — CID 143751054
[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-(2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanone (PubChem CID 143751054) has the molecular formula C23H25ClO5 and a molecular weight of 416.90 g/mol. Its IUPAC name is [4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-(2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanone.
| Compound Name | [4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-(2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanone |
|---|---|
| PubChem CID | 143751054 |
| Molecular Formula | C23H25ClO5 |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-(2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanone |
| SMILES | CCOc1ccc(Cc2cc(C(=O)C3CC4OC(C)(C)OC4O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H25ClO5/c1-4-26-17-8-5-14(6-9-17)11-16-12-15(7-10-18(16)24)21(25)19-13-20-22(27-19)29-23(2,3)28-20/h5-10,12,19-20,22H,4,11,13H2,1-3H3 |
| InChIKey | HCUNMKCYUMTPKH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |