C27H31ClO9 — CID 123737769
[4,5-diacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 123737769) has the molecular formula C27H31ClO9 and a molecular weight of 534.99 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 123737769 |
| Molecular Formula | C27H31ClO9 |
| Molecular Weight | 534.99 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | [4,5-diacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CCOc1ccc(Cc2cc(C3OC(CO)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C27H31ClO9/c1-5-33-21-9-6-18(7-10-21)12-20-13-19(8-11-22(20)28)24-26(35-16(3)31)27(36-17(4)32)25(34-15(2)30)23(14-29)37-24/h6-11,13,23-27,29H,5,12,14H2,1-4H3 |
| InChIKey | IBDLDDROVCTNCT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.99 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|