C26H28ClNO9 — CID 90868451
[(2S,3S,4R,5S)-3,5-diacetyloxy-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-nitrosooxan-4-yl] acetate (PubChem CID 90868451) has the molecular formula C26H28ClNO9 and a molecular weight of 533.96 g/mol. Its IUPAC name is [(2S,3S,4R,5S)-3,5-diacetyloxy-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-nitrosooxan-4-yl] acetate.
| Compound Name | [(2S,3S,4R,5S)-3,5-diacetyloxy-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-nitrosooxan-4-yl] acetate |
|---|---|
| PubChem CID | 90868451 |
| Molecular Formula | C26H28ClNO9 |
| Molecular Weight | 533.96 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | [(2S,3S,4R,5S)-3,5-diacetyloxy-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-nitrosooxan-4-yl] acetate |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3OC(N=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H28ClNO9/c1-5-33-20-9-6-17(7-10-20)12-19-13-18(8-11-21(19)27)22-23(34-14(2)29)24(35-15(3)30)25(36-16(4)31)26(28-32)37-22/h6-11,13,22-26H,5,12H2,1-4H3/t22-,23-,24+,25-,26?/m0/s1 |
| InChIKey | SODFIXRBNIZVRH-JINQPGJFSA-N |
| XLogP | 4.29 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|