C16H17NO5 — CID 129440816
[(3aR,4S,6S,6aS)-4-cyano-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate (PubChem CID 129440816) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is [(3aR,4S,6S,6aS)-4-cyano-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate.
| Compound Name | [(3aR,4S,6S,6aS)-4-cyano-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 129440816 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [(3aR,4S,6S,6aS)-4-cyano-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](C#N)O[C@H]2COC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO5/c1-16(2)21-13-11(8-17)20-12(14(13)22-16)9-19-15(18)10-6-4-3-5-7-10/h3-7,11-14H,9H2,1-2H3/t11-,12-,13+,14-/m0/s1 |
| InChIKey | VWDYAAUYNGIMEZ-FQUUOJAGSA-N |
| XLogP | 1.65 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |