C15H18O4S — CID 10859362
[(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]methyl benzoate (PubChem CID 10859362) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]methyl benzoate.
| Compound Name | [(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 10859362 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]methyl benzoate |
| SMILES | CC1(C)O[C@H]2[C@H](CS[C@@H]2COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C15H18O4S/c1-15(2)18-11-9-20-12(13(11)19-15)8-17-14(16)10-6-4-3-5-7-10/h3-7,11-13H,8-9H2,1-2H3/t11-,12+,13-/m0/s1 |
| InChIKey | GVDGGDZDDZVKBN-XQQFMLRXSA-N |
| XLogP | 2.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |