C18H24O7S — CID 102073256
[(3aS,4R,6R,7R,7aS)-6-hydroxy-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-4-yl]methyl benzoate (PubChem CID 102073256) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is [(3aS,4R,6R,7R,7aS)-6-hydroxy-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-4-yl]methyl benzoate.
| Compound Name | [(3aS,4R,6R,7R,7aS)-6-hydroxy-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 102073256 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(3aS,4R,6R,7R,7aS)-6-hydroxy-7-(methoxymethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-4-yl]methyl benzoate |
| SMILES | COCO[C@@H]1[C@H]2OC(C)(C)O[C@@H]2[C@@H](COC(=O)c2ccccc2)S[C@H]1O |
| InChI | InChI=1S/C18H24O7S/c1-18(2)24-13-12(9-22-16(19)11-7-5-4-6-8-11)26-17(20)15(14(13)25-18)23-10-21-3/h4-8,12-15,17,20H,9-10H2,1-3H3/t12-,13-,14+,15-,17-/m1/s1 |
| InChIKey | OCDVFQSFVFJZSJ-OWVAZHOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|