C15H18O5S — CID 144931017
(4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl)methyl benzoate (PubChem CID 144931017) has the molecular formula C15H18O5S and a molecular weight of 310.37 g/mol. Its IUPAC name is (4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl)methyl benzoate.
| Compound Name | (4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl)methyl benzoate |
|---|---|
| PubChem CID | 144931017 |
| Molecular Formula | C15H18O5S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl)methyl benzoate |
| SMILES | CC1(C)OC2C(O)SC(COC(=O)c3ccccc3)C2O1 |
| InChI | InChI=1S/C15H18O5S/c1-15(2)19-11-10(21-14(17)12(11)20-15)8-18-13(16)9-6-4-3-5-7-9/h3-7,10-12,14,17H,8H2,1-2H3 |
| InChIKey | IKWZSHKZERQXIH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |