C15H20NO8P — CID 168832144
[(3aS,4R,6S)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate (PubChem CID 168832144) has the molecular formula C15H20NO8P and a molecular weight of 373.30 g/mol. Its IUPAC name is [(3aS,4R,6S)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate.
| Compound Name | [(3aS,4R,6S)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 168832144 |
| Molecular Formula | C15H20NO8P |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [(3aS,4R,6S)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
| SMILES | CC1(C)OC2[C@H](COP(=O)(O)O)O[C@H](c3cccc(C(N)=O)c3)[C@@H]2O1 |
| InChI | InChI=1S/C15H20NO8P/c1-15(2)23-12-10(7-21-25(18,19)20)22-11(13(12)24-15)8-4-3-5-9(6-8)14(16)17/h3-6,10-13H,7H2,1-2H3,(H2,16,17)(H2,18,19,20)/t10-,11+,12?,13-/m0/s1 |
| InChIKey | XXKQVPOQFMQSRV-HNGCFSAESA-N |
| XLogP | 0.85 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|