C15H19NO8P- — CID 168832126
[(4R,6S,6aR)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate (PubChem CID 168832126) has the molecular formula C15H19NO8P- and a molecular weight of 372.29 g/mol. Its IUPAC name is [(4R,6S,6aR)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate.
| Compound Name | [(4R,6S,6aR)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 168832126 |
| Molecular Formula | C15H19NO8P- |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [(4R,6S,6aR)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate |
| SMILES | CC1(C)OC2[C@@H](c3cccc(C(N)=O)c3)O[C@@H](COP(=O)([O-])O)[C@H]2O1 |
| InChI | InChI=1S/C15H20NO8P/c1-15(2)23-12-10(7-21-25(18,19)20)22-11(13(12)24-15)8-4-3-5-9(6-8)14(16)17/h3-6,10-13H,7H2,1-2H3,(H2,16,17)(H2,18,19,20)/p-1/t10-,11+,12+,13?/m0/s1 |
| InChIKey | XXKQVPOQFMQSRV-VCKSIFHUSA-M |
| XLogP | 0.22 |
| TPSA | 140.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|