C16H20O7 — CID 123856643
(3-acetyloxy-4,5-dihydroxy-6-phenyloxan-2-yl)methyl acetate (PubChem CID 123856643) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is (3-acetyloxy-4,5-dihydroxy-6-phenyloxan-2-yl)methyl acetate.
| Compound Name | (3-acetyloxy-4,5-dihydroxy-6-phenyloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 123856643 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (3-acetyloxy-4,5-dihydroxy-6-phenyloxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(c2ccccc2)C(O)C(O)C1OC(C)=O |
| InChI | InChI=1S/C16H20O7/c1-9(17)21-8-12-16(22-10(2)18)14(20)13(19)15(23-12)11-6-4-3-5-7-11/h3-7,12-16,19-20H,8H2,1-2H3 |
| InChIKey | IOIZCVMAKQBSIL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |