C22H31BO9 — CID 123839028
[3-acetyloxy-4,5-dihydroxy-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-2-yl]methyl acetate (PubChem CID 123839028) has the molecular formula C22H31BO9 and a molecular weight of 450.29 g/mol. Its IUPAC name is [3-acetyloxy-4,5-dihydroxy-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-4,5-dihydroxy-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123839028 |
| Molecular Formula | C22H31BO9 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | [3-acetyloxy-4,5-dihydroxy-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C(O)C(O)C1OC(C)=O |
| InChI | InChI=1S/C22H31BO9/c1-12(24)28-11-16-20(29-13(2)25)18(27)17(26)19(30-16)14-7-9-15(10-8-14)23-31-21(3,4)22(5,6)32-23/h7-10,16-20,26-27H,11H2,1-6H3 |
| InChIKey | RTXFCCNJOCITDI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|