C20H23N2O9+ — CID 101272024
4-[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]benzenediazonium (PubChem CID 101272024) has the molecular formula C20H23N2O9+ and a molecular weight of 435.41 g/mol. Its IUPAC name is 4-[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]benzenediazonium.
| Compound Name | 4-[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]benzenediazonium |
|---|---|
| PubChem CID | 101272024 |
| Molecular Formula | C20H23N2O9+ |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]benzenediazonium |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc([N+]#N)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H23N2O9/c1-10(23)27-9-16-18(28-11(2)24)20(30-13(4)26)19(29-12(3)25)17(31-16)14-5-7-15(22-21)8-6-14/h5-8,16-20H,9H2,1-4H3/q+1/t16-,17+,18+,19+,20+/m1/s1 |
| InChIKey | ARLRKDWROABNMM-DEPCRRQNSA-N |
| XLogP | 1.97 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|