C21H24BrClO9 — CID 89287788
[(6S)-3,4,5-triacetyloxy-6-[3-(bromomethyl)-4-chlorophenyl]oxan-2-yl]methyl acetate (PubChem CID 89287788) has the molecular formula C21H24BrClO9 and a molecular weight of 535.77 g/mol. Its IUPAC name is [(6S)-3,4,5-triacetyloxy-6-[3-(bromomethyl)-4-chlorophenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(6S)-3,4,5-triacetyloxy-6-[3-(bromomethyl)-4-chlorophenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89287788 |
| Molecular Formula | C21H24BrClO9 |
| Molecular Weight | 535.77 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | [(6S)-3,4,5-triacetyloxy-6-[3-(bromomethyl)-4-chlorophenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](c2ccc(Cl)c(CBr)c2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H24BrClO9/c1-10(24)28-9-17-19(29-11(2)25)21(31-13(4)27)20(30-12(3)26)18(32-17)14-5-6-16(23)15(7-14)8-22/h5-7,17-21H,8-9H2,1-4H3/t17?,18-,19?,20?,21?/m0/s1 |
| InChIKey | PFTXRJXOKDZKCP-ANSLWWGBSA-N |
| XLogP | 3.03 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|