C29H31ClO10 — CID 59557758
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[(4-acetylphenyl)methyl]-4-chlorophenyl]oxan-2-yl]methyl acetate (PubChem CID 59557758) has the molecular formula C29H31ClO10 and a molecular weight of 575.01 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[(4-acetylphenyl)methyl]-4-chlorophenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[(4-acetylphenyl)methyl]-4-chlorophenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59557758 |
| Molecular Formula | C29H31ClO10 |
| Molecular Weight | 575.01 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[(4-acetylphenyl)methyl]-4-chlorophenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(C(C)=O)cc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H31ClO10/c1-15(31)21-8-6-20(7-9-21)12-23-13-22(10-11-24(23)30)26-28(38-18(4)34)29(39-19(5)35)27(37-17(3)33)25(40-26)14-36-16(2)32/h6-11,13,25-29H,12,14H2,1-5H3/t25-,26+,27-,28+,29+/m1/s1 |
| InChIKey | OLYGTHDWYHRYQO-ZCCUTQAASA-N |
| XLogP | 3.93 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.01 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|