C25H27ClO9 — CID 146686588
[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-3-hydroxyoxan-2-yl]methyl acetate (PubChem CID 146686588) has the molecular formula C25H27ClO9 and a molecular weight of 506.94 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-3-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-3-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 146686588 |
| Molecular Formula | C25H27ClO9 |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-3-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(O)cc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C25H27ClO9/c1-13(27)32-12-21-22(31)24(33-14(2)28)25(34-15(3)29)23(35-21)17-6-9-20(26)18(11-17)10-16-4-7-19(30)8-5-16/h4-9,11,21-25,30-31H,10,12H2,1-3H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | PSSFPQMJOJZVGN-VAFBSOEGSA-N |
| XLogP | 2.86 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|