C31H35ClO10 — CID 71142732
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[1-(hydroxymethyl)cyclopropyl]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 71142732) has the molecular formula C31H35ClO10 and a molecular weight of 603.06 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[1-(hydroxymethyl)cyclopropyl]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[1-(hydroxymethyl)cyclopropyl]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71142732 |
| Molecular Formula | C31H35ClO10 |
| Molecular Weight | 603.06 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[1-(hydroxymethyl)cyclopropyl]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(C4(CO)CC4)cc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H35ClO10/c1-17(34)38-15-26-28(39-18(2)35)30(41-20(4)37)29(40-19(3)36)27(42-26)22-7-10-25(32)23(14-22)13-21-5-8-24(9-6-21)31(16-33)11-12-31/h5-10,14,26-30,33H,11-13,15-16H2,1-4H3/t26-,27+,28-,29+,30+/m1/s1 |
| InChIKey | ZQPSQXDMFUNCMS-MYOTWTRRSA-N |
| XLogP | 3.75 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.06 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|