C32H37ClO9Si — CID 71117136
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(2-trimethylsilylethynyl)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 71117136) has the molecular formula C32H37ClO9Si and a molecular weight of 629.18 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(2-trimethylsilylethynyl)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(2-trimethylsilylethynyl)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71117136 |
| Molecular Formula | C32H37ClO9Si |
| Molecular Weight | 629.18 g/mol |
| Exact Mass | 628.19 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(2-trimethylsilylethynyl)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(C#C[Si](C)(C)C)cc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H37ClO9Si/c1-19(34)38-18-28-30(39-20(2)35)32(41-22(4)37)31(40-21(3)36)29(42-28)25-12-13-27(33)26(17-25)16-24-10-8-23(9-11-24)14-15-43(5,6)7/h8-13,17,28-32H,16,18H2,1-7H3/t28-,29+,30-,31+,32+/m1/s1 |
| InChIKey | VBADHBYRSQVHNC-OXFURMMHSA-N |
| XLogP | 4.96 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.18 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|