C28H28ClF3O12S — CID 86729316
[(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 86729316) has the molecular formula C28H28ClF3O12S and a molecular weight of 681.03 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86729316 |
| Molecular Formula | C28H28ClF3O12S |
| Molecular Weight | 681.03 g/mol |
| Exact Mass | 680.09 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](c2ccc(Cl)c(Cc3ccc(OS(=O)(=O)C(F)(F)F)cc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H28ClF3O12S/c1-14(33)39-13-23-25(40-15(2)34)27(42-17(4)36)26(41-16(3)35)24(43-23)19-7-10-22(29)20(12-19)11-18-5-8-21(9-6-18)44-45(37,38)28(30,31)32/h5-10,12,23-27H,11,13H2,1-4H3/t23-,24-,25-,26+,27+/m1/s1 |
| InChIKey | IARIHOASGLQDRK-XCRFIODOSA-N |
| XLogP | 3.96 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.03 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|